Products 2416442-06-1
CAS 2416442-06-1 appears in our catalog under these names: 4,4′–Methylenedianiline–15N2, 13C, 4,4′-Methylenedianiline-15N2,13C, 99.41%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
4-[(4-(15N)azanylphenyl)(113C)methyl](15N2)aniline (CAS 2416442-06-1) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 201.24 g/mol. IUPAC name: 4-[(4-(15N)azanylphenyl)(113C)methyl](15N2)aniline. InChIKey: YBRVSVVVWCFQMG-HPEOUSIPSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 201.24 g/mol |
| IUPAC name | 4-[(4-(15N)azanylphenyl)(113C)methyl](15N2)aniline |
| InChIKey | YBRVSVVVWCFQMG-HPEOUSIPSA-N |
| SMILES | C1=CC(=CC=C1[13CH2]C2=CC=C(C=C2)[15NH2])[15NH2] |
Computed by PubChem (NCBI)