Products 2416992-63-5
CAS 2416992-63-5 is the registry number for tert-Butyl (1-acryloylazetidin-3-yl)carbamate, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl N-(1-prop-2-enoylazetidin-3-yl)carbamate (CAS 2416992-63-5) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: tert-butyl N-(1-prop-2-enoylazetidin-3-yl)carbamate. InChIKey: VKJIAQGBWLIDOB-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | tert-butyl N-(1-prop-2-enoylazetidin-3-yl)carbamate |
| InChIKey | VKJIAQGBWLIDOB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CN(C1)C(=O)C=C |
Computed by PubChem (NCBI)