CAS 2417258-70-7 is the registry number for E3 ligase Ligand 65. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(6-hydroxy-4-methoxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2417258-70-7) is a chemical compound with the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. IUPAC name: 3-(6-hydroxy-4-methoxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: GPEUBZHCXXCATP-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O5 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | 3-(6-hydroxy-4-methoxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | GPEUBZHCXXCATP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1C(=O)N(C2)C3CCC(=O)NC3=O)O |
Computed by PubChem (NCBI)