Products 24245-01-0
CAS 24245-01-0 appears in our catalog under these names: 4-((2,6-Dimethylphenyl)amino)-4-oxobutanoic acid, 95%, 4-((2,6-Dimethylphenyl)amino)-4-oxobutanoic acid, 95+%, 4-(2,6-Dimethylanilino)-4-oxobutanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-(2,6-dimethylanilino)-4-oxobutanoic acid (CAS 24245-01-0) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-(2,6-dimethylanilino)-4-oxobutanoic acid. InChIKey: ANORGLROOXVGGO-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-(2,6-dimethylanilino)-4-oxobutanoic acid |
| InChIKey | ANORGLROOXVGGO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(2,6-dimethylanilino)-4-oxobutanoic acid, N-(2,6-Dimethyl-phenyl)-succinamic acid, 3-[(2,6-dimethylphenyl)carbamoyl]propanoic acid, 4-[(2,6-dimethylphenyl)amino]-4-oxobutanoic acid, 4-((2,6-dimethylphenyl)amino)-4-oxobutanoic acid, Oprea1_610977, Oprea1_782449, CBDivE_009931, N-(2,6-Dimethylphenyl)succinamic acid, 4-(2,6-dimethylanilino)-4-oxo-butanoic acid