Products 24260-05-7
CAS 24260-05-7 appears in our catalog under these names: Benzenemethanamine, α-cyclopentyl-, hydrochloride (1:1), 98%, 98%, C-Cyclopentyl-C-phenyl-methylamine hydrochloride, 98%, Cyclopentyl(phenyl)methanamine hydrochloride, 98%, Benzenemethanamine, α-cyclopentyl-, hydrochloride (1:1), 98%. Offered by: Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg.
Cyclopentyl(phenyl)methanamine;hydrochloride (CAS 24260-05-7) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: cyclopentyl(phenyl)methanamine;hydrochloride. InChIKey: MWNLQCUCZDOTEE-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | cyclopentyl(phenyl)methanamine;hydrochloride |
| InChIKey | MWNLQCUCZDOTEE-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)