Products 2432848-83-2
CAS 2432848-83-2 appears in our catalog under these names: 4,5-Dichloro-2-fluoro-3-methylbenzoic acid, 95%, 4,5-Dichloro-2-fluoro-3-methylbenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
4,5-dichloro-2-fluoro-3-methylbenzoic acid (CAS 2432848-83-2) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: 4,5-dichloro-2-fluoro-3-methylbenzoic acid. InChIKey: YBWYXKJXVJWICY-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | 4,5-dichloro-2-fluoro-3-methylbenzoic acid |
| InChIKey | YBWYXKJXVJWICY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1Cl)Cl)C(=O)O)F |
Computed by PubChem (NCBI)