Products 2432911-31-2
CAS 2432911-31-2 appears in our catalog under these names: Brivaracetam Impurity 16, Brivaracetam Impurity 68, (2S)-2-(2,5-Dioxo-3-propylpyrrolidin-1-yl)butanamide. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-2-[(3R)-2,5-dioxo-3-propylpyrrolidin-1-yl]butanamide (CAS 2432911-31-2) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: (2S)-2-[(3R)-2,5-dioxo-3-propylpyrrolidin-1-yl]butanamide. InChIKey: GOYHZRHCXPMPED-SFYZADRCSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | (2S)-2-[(3R)-2,5-dioxo-3-propylpyrrolidin-1-yl]butanamide |
| InChIKey | GOYHZRHCXPMPED-SFYZADRCSA-N |
| SMILES | CCC[C@@H]1CC(=O)N(C1=O)[C@@H](CC)C(=O)N |
Computed by PubChem (NCBI)