Products 2433736-95-7
CAS 2433736-95-7 is the registry number for Fmoc-NH-cis-cyclooct-4-ene-COOH. Offered by: Iris Biotech. Available pack sizes: 1g.
(1R,4Z,8S)-8-(9H-fluoren-9-ylmethoxycarbonylamino)cyclooct-4-ene-1-carboxylic acid (CAS 2433736-95-7) is a chemical compound with the molecular formula C24H25NO4 and a molecular weight of 391.5 g/mol. IUPAC name: (1R,4Z,8S)-8-(9H-fluoren-9-ylmethoxycarbonylamino)cyclooct-4-ene-1-carboxylic acid. InChIKey: BRHLMAPSYHOIMG-JXHMKXPISA-N.
| Molecular formula | C24H25NO4 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | (1R,4Z,8S)-8-(9H-fluoren-9-ylmethoxycarbonylamino)cyclooct-4-ene-1-carboxylic acid |
| InChIKey | BRHLMAPSYHOIMG-JXHMKXPISA-N |
| SMILES | C/1C[C@H]([C@H](CC/C=C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)