CAS 243455-57-4 appears in our catalog under these names: 5–(3–Bromophenyl)oxazole, 5-(3-Bromophenyl)-1,3-oxazole, 5-(3-Bromophenyl)oxazole 98%, 5-(3-Bromophenyl)-1,3-oxazole, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g.
5-(3-bromophenyl)-1,3-oxazole (CAS 243455-57-4) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 5-(3-bromophenyl)-1,3-oxazole. InChIKey: GUYZQMXSOVOSIC-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 5-(3-bromophenyl)-1,3-oxazole |
| InChIKey | GUYZQMXSOVOSIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CN=CO2 |
Computed by PubChem (NCBI)