Products 2435554-11-1
CAS 2435554-11-1 is the registry number for Benzyl (S)-(1-((tert-butoxycarbonyl)amino)propan-2-yl)(methyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-methyl-N-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]carbamate (CAS 2435554-11-1) is a chemical compound with the molecular formula C17H26N2O4 and a molecular weight of 322.4 g/mol. IUPAC name: benzyl N-methyl-N-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]carbamate. InChIKey: YKKLEPCYTDDPGA-ZDUSSCGKSA-N.
| Molecular formula | C17H26N2O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | benzyl N-methyl-N-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]carbamate |
| InChIKey | YKKLEPCYTDDPGA-ZDUSSCGKSA-N |
| SMILES | C[C@@H](CNC(=O)OC(C)(C)C)N(C)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)