CAS 243659-11-2 appears in our catalog under these names: Benzyl 2-chloro-2-fluoroacetate, 97%, Benzyl chlorofluoroacetate, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 25g, 5g, 1g.
Benzyl 2-chloro-2-fluoroacetate (CAS 243659-11-2) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: benzyl 2-chloro-2-fluoroacetate. InChIKey: MWMVSSKZRABAIJ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | benzyl 2-chloro-2-fluoroacetate |
| InChIKey | MWMVSSKZRABAIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(F)Cl |
Computed by PubChem (NCBI)