CAS 243659-15-6 appears in our catalog under these names: 4-(Difluoromethoxy)phenylacetic acid, 95%, 2–(4–(Difluoromethoxy)phenyl)acetic acid, 2-(4-(Difluoromethoxy)phenyl)acetic acid, 98%, 98%, 4-(Difluoromethoxy)phenylacetic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 250mg, 100mg, 500mg.
2-[4-(difluoromethoxy)phenyl]acetic acid (CAS 243659-15-6) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2-[4-(difluoromethoxy)phenyl]acetic acid. InChIKey: QAIYQXXEMHGUNB-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2-[4-(difluoromethoxy)phenyl]acetic acid |
| InChIKey | QAIYQXXEMHGUNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)OC(F)F |
Computed by PubChem (NCBI)