CAS 243987-44-2 is the registry number for Maltol Related Compound 2. Offered by: Chemat Brand. Available pack sizes: on request.
3-hydroxy-N,1,6-trimethyl-4-oxopyridine-2-carboxamide (CAS 243987-44-2) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 3-hydroxy-N,1,6-trimethyl-4-oxopyridine-2-carboxamide. InChIKey: JFWSELHOSFRVMD-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3-hydroxy-N,1,6-trimethyl-4-oxopyridine-2-carboxamide |
| InChIKey | JFWSELHOSFRVMD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=C(N1C)C(=O)NC)O |
Computed by PubChem (NCBI)