CAS 244057-31-6 appears in our catalog under these names: 2-(2,6-Dioxopiperidin-3-yl)-4-methylisoindoline-1,3-dione, 98%, 4-Me-Thalidomide 95%, 4-Me-Thalidomide, 4-Me-Thalidomide, 98%. Offered by: Chemat Brand, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, Get quote.
2-(2,6-dioxopiperidin-3-yl)-4-methylisoindole-1,3-dione (CAS 244057-31-6) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-4-methylisoindole-1,3-dione. InChIKey: PUEJOCVNXNAMGP-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-4-methylisoindole-1,3-dione |
| InChIKey | PUEJOCVNXNAMGP-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)N(C2=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)