Products 24434-90-0
CAS 24434-90-0 is the registry number for 3-(carboxymethyl)cyclopentane-1,2,4-tricarboxylic Acid, 98%. Offered by: Chemat. Available pack sizes: 25g, 100g.
3-(carboxymethyl)cyclopentane-1,2,4-tricarboxylic acid (CAS 24434-90-0) is a chemical compound with the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. IUPAC name: 3-(carboxymethyl)cyclopentane-1,2,4-tricarboxylic acid. InChIKey: RHRNYXVSZLSRRP-UHFFFAOYSA-N.
| Molecular formula | C10H12O8 |
|---|---|
| Molecular weight | 260.20 g/mol |
| IUPAC name | 3-(carboxymethyl)cyclopentane-1,2,4-tricarboxylic acid |
| InChIKey | RHRNYXVSZLSRRP-UHFFFAOYSA-N |
| SMILES | C1C(C(C(C1C(=O)O)C(=O)O)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)