Products 24445-06-5
CAS 24445-06-5 appears in our catalog under these names: 1H,4H,5H-Benzo[g]indazole, 97%, 4,5-Dihydro-1H-benzo[g]indazole, 97%, 97%, 2H,4H,5H-benzo[g]indazole, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
4,5-dihydro-1H-benzo[g]indazole (CAS 24445-06-5) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 4,5-dihydro-1H-benzo[g]indazole. InChIKey: IJZPDJZOELSEKV-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 4,5-dihydro-1H-benzo[g]indazole |
| InChIKey | IJZPDJZOELSEKV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)NN=C2 |
Computed by PubChem (NCBI)