Products 2446503-35-9
CAS 2446503-35-9 is the registry number for tert-Butyl (3-(4-chloro-2-methylphenyl)prop-2-yn-1-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[3-(4-chloro-2-methylphenyl)prop-2-ynyl]carbamate (CAS 2446503-35-9) is a chemical compound with the molecular formula C15H18ClNO2 and a molecular weight of 279.76 g/mol. IUPAC name: tert-butyl N-[3-(4-chloro-2-methylphenyl)prop-2-ynyl]carbamate. InChIKey: XZDOUZAOZDWOSS-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO2 |
|---|---|
| Molecular weight | 279.76 g/mol |
| IUPAC name | tert-butyl N-[3-(4-chloro-2-methylphenyl)prop-2-ynyl]carbamate |
| InChIKey | XZDOUZAOZDWOSS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C#CCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)