CAS 7441-28-3 appears in our catalog under these names: 1,1-Bis(4-methoxyphenyl)methanamine hydrochloride, 95%, Bis(4-methoxyphenyl)methanamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Bis(4-methoxyphenyl)methanamine;hydrochloride (CAS 7441-28-3) is a chemical compound with the molecular formula C15H18ClNO2 and a molecular weight of 279.76 g/mol. IUPAC name: bis(4-methoxyphenyl)methanamine;hydrochloride. InChIKey: VUYJSDIFRBOLNX-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO2 |
|---|---|
| Molecular weight | 279.76 g/mol |
| IUPAC name | bis(4-methoxyphenyl)methanamine;hydrochloride |
| InChIKey | VUYJSDIFRBOLNX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)N.Cl |
Computed by PubChem (NCBI)