CAS 400079-95-0 is the registry number for 1-(tert-Butyl)-6-(4-chlorophenyl)dihydro-2,4(1h,3h)-pyridinedione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-tert-butyl-6-(4-chlorophenyl)piperidine-2,4-dione (CAS 400079-95-0) is a chemical compound with the molecular formula C15H18ClNO2 and a molecular weight of 279.76 g/mol. IUPAC name: 1-tert-butyl-6-(4-chlorophenyl)piperidine-2,4-dione. InChIKey: QJXWLZMEEFVVIH-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO2 |
|---|---|
| Molecular weight | 279.76 g/mol |
| IUPAC name | 1-tert-butyl-6-(4-chlorophenyl)piperidine-2,4-dione |
| InChIKey | QJXWLZMEEFVVIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(CC(=O)CC1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)