Products 50537-11-6

CAS 50537-11-6 is the registry number for Ethyl 2-(3-Chloro-4-(3-pyrrolin-1-yl)phenyl)propionate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[3-chloro-4-(2,5-dihydropyrrol-1-yl)phenyl]propanoate (CAS 50537-11-6) is a chemical compound with the molecular formula C15H18ClNO2 and a molecular weight of 279.76 g/mol. IUPAC name: ethyl 2-[3-chloro-4-(2,5-dihydropyrrol-1-yl)phenyl]propanoate. InChIKey: GVFDOKOKJHREEP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18ClNO2
Molecular weight279.76 g/mol
IUPAC nameethyl 2-[3-chloro-4-(2,5-dihydropyrrol-1-yl)phenyl]propanoate
InChIKeyGVFDOKOKJHREEP-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)C1=CC(=C(C=C1)N2CC=CC2)Cl

Computed by PubChem (NCBI)