Products 24503-25-1

CAS 24503-25-1 is the registry number for Metformin Impurity 19 HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diaminomethylidene-(4-ethoxycarbonylphenyl)azanium chloride (CAS 24503-25-1) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: diaminomethylidene-(4-ethoxycarbonylphenyl)azanium chloride. InChIKey: JVKHTQOESNXCQB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClN3O2
Molecular weight243.69 g/mol
IUPAC namediaminomethylidene-(4-ethoxycarbonylphenyl)azanium chloride
InChIKeyJVKHTQOESNXCQB-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)[NH+]=C(N)N.[Cl-]

Computed by PubChem (NCBI)