CAS 24503-25-1 is the registry number for Metformin Impurity 19 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
Diaminomethylidene-(4-ethoxycarbonylphenyl)azanium chloride (CAS 24503-25-1) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: diaminomethylidene-(4-ethoxycarbonylphenyl)azanium chloride. InChIKey: JVKHTQOESNXCQB-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | diaminomethylidene-(4-ethoxycarbonylphenyl)azanium chloride |
| InChIKey | JVKHTQOESNXCQB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)[NH+]=C(N)N.[Cl-] |
Computed by PubChem (NCBI)