Products 2451082-05-4
CAS 2451082-05-4 is the registry number for 5'-Methyl-[1,1':3',1''-terphenyl]-3,3''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3-(3-carboxyphenyl)-5-methylphenyl]benzoic acid (CAS 2451082-05-4) is a chemical compound with the molecular formula C21H16O4 and a molecular weight of 332.3 g/mol. IUPAC name: 3-[3-(3-carboxyphenyl)-5-methylphenyl]benzoic acid. InChIKey: LCEZMJMCWNWITE-UHFFFAOYSA-N.
| Molecular formula | C21H16O4 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | 3-[3-(3-carboxyphenyl)-5-methylphenyl]benzoic acid |
| InChIKey | LCEZMJMCWNWITE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC(=CC=C2)C(=O)O)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)