CAS 14756-24-2 appears in our catalog under these names: 3',4'-Dimethoxy-alpha-naphthoflavone, DiMNF, DiMNF 98%, DiMNF, 98.46%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 2mg, 10mg, 50mg, 250mg, 1g, 1mg, 5mg.
2-(3,4-dimethoxyphenyl)benzo[h]chromen-4-one (CAS 14756-24-2) is a chemical compound with the molecular formula C21H16O4 and a molecular weight of 332.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)benzo[h]chromen-4-one. InChIKey: QDZQDIUUJDAORK-UHFFFAOYSA-N.
| Molecular formula | C21H16O4 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)benzo[h]chromen-4-one |
| InChIKey | QDZQDIUUJDAORK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(O2)C4=CC=CC=C4C=C3)OC |
Computed by PubChem (NCBI)