CAS 643755-84-4 appears in our catalog under these names: 6-Hydroxy-9-(4-methoxy-2-methylphenyl)-3h-xanthen-3-one, 95%, 6–Hydroxy–9–(4–methoxy–2–methylphenyl)–3H–xanthen–3–one, 6-Hydroxy-9-(4-methoxy-2-methylphenyl)-3H-xanthen-3-one 95%, 6-Hydroxy-9-(4-methoxy-2-methylphenyl)-3H-xanthen-3-one, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-hydroxy-9-(4-methoxy-2-methylphenyl)xanthen-3-one (CAS 643755-84-4) is a chemical compound with the molecular formula C21H16O4 and a molecular weight of 332.3 g/mol. IUPAC name: 6-hydroxy-9-(4-methoxy-2-methylphenyl)xanthen-3-one. InChIKey: ZJQWKLCFUMLLGQ-UHFFFAOYSA-N.
| Molecular formula | C21H16O4 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | 6-hydroxy-9-(4-methoxy-2-methylphenyl)xanthen-3-one |
| InChIKey | ZJQWKLCFUMLLGQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC)C2=C3C=CC(=O)C=C3OC4=C2C=CC(=C4)O |
Computed by PubChem (NCBI)