CAS 104311-36-6 appears in our catalog under these names: 3-(Benzoyloxy)-5-methylphenyl benzoate, 95%, 3,5-Dibenzoyloxytoluene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
(3-benzoyloxy-5-methylphenyl) benzoate (CAS 104311-36-6) is a chemical compound with the molecular formula C21H16O4 and a molecular weight of 332.3 g/mol. IUPAC name: (3-benzoyloxy-5-methylphenyl) benzoate. InChIKey: AUQZHPLWIXEVCC-UHFFFAOYSA-N.
| Molecular formula | C21H16O4 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | (3-benzoyloxy-5-methylphenyl) benzoate |
| InChIKey | AUQZHPLWIXEVCC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)