CAS 1582811-97-9 appears in our catalog under these names: 5'–Methyl–(1,1':3',1''–terphenyl)–4,4''–dicarboxylic acid, 5'-methyl-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 98%, 98%, 5'-Methyl-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
4-[3-(4-carboxyphenyl)-5-methylphenyl]benzoic acid (CAS 1582811-97-9) is a chemical compound with the molecular formula C21H16O4 and a molecular weight of 332.3 g/mol. IUPAC name: 4-[3-(4-carboxyphenyl)-5-methylphenyl]benzoic acid. InChIKey: XTEFXDSIWNENNF-UHFFFAOYSA-N.
| Molecular formula | C21H16O4 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | 4-[3-(4-carboxyphenyl)-5-methylphenyl]benzoic acid |
| InChIKey | XTEFXDSIWNENNF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)