CAS 2561517-87-9 appears in our catalog under these names: (R)-(1-((3-Fluoropyrrolidin-1-yl)methyl)cyclopropyl)methanol, 97%, 97%, [1-[[(3R)-3-FLUOROPYRROLIDIN-1-YL]METHYL]CYCLOPROPYL]METHANOL, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
[1-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]cyclopropyl]methanol (CAS 2561517-87-9) is a chemical compound with the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. IUPAC name: [1-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]cyclopropyl]methanol. InChIKey: QJQCVYXQIGSXLS-MRVPVSSYSA-N.
| Molecular formula | C9H16FNO |
|---|---|
| Molecular weight | 173.23 g/mol |
| IUPAC name | [1-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]cyclopropyl]methanol |
| InChIKey | QJQCVYXQIGSXLS-MRVPVSSYSA-N |
| SMILES | C1CN(C[C@@H]1F)CC2(CC2)CO |
Computed by PubChem (NCBI)