Products 2454491-15-5
CAS 2454491-15-5 appears in our catalog under these names: 4-Amino-6-chloro-5-fluoronicotinic acid, 95%, 95%, 4-Amino-6-chloro-5-fluoronicotinic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-amino-6-chloro-5-fluoropyridine-3-carboxylic acid (CAS 2454491-15-5) is a chemical compound with the molecular formula C6H4ClFN2O2 and a molecular weight of 190.56 g/mol. IUPAC name: 4-amino-6-chloro-5-fluoropyridine-3-carboxylic acid. InChIKey: GZBFTGIOXCYNSW-UHFFFAOYSA-N.
| Molecular formula | C6H4ClFN2O2 |
|---|---|
| Molecular weight | 190.56 g/mol |
| IUPAC name | 4-amino-6-chloro-5-fluoropyridine-3-carboxylic acid |
| InChIKey | GZBFTGIOXCYNSW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)F)N)C(=O)O |
Computed by PubChem (NCBI)