CAS 245547-25-5 is the registry number for 1-((4-Aminophenyl)methyl)pyrrolidine-2,5-dione. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-[(4-aminophenyl)methyl]pyrrolidine-2,5-dione (CAS 245547-25-5) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 1-[(4-aminophenyl)methyl]pyrrolidine-2,5-dione. InChIKey: NOQQYOLOKNTPKK-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 1-[(4-aminophenyl)methyl]pyrrolidine-2,5-dione |
| InChIKey | NOQQYOLOKNTPKK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)CC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)