Products 2459946-56-4
CAS 2459946-56-4 is the registry number for tert-Butyl (3aR,6aR)-2-phenylhexahydropyrrolo[3,4-c]pyrrole-3a(1H)-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 200mg.
Tert-butyl (3aR,6aR)-5-phenyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylate (CAS 2459946-56-4) is a chemical compound with the molecular formula C17H24N2O2 and a molecular weight of 288.4 g/mol. IUPAC name: tert-butyl (3aR,6aR)-5-phenyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylate. InChIKey: GKVZHNAAJRLMQI-CXAGYDPISA-N.
| Molecular formula | C17H24N2O2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | tert-butyl (3aR,6aR)-5-phenyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylate |
| InChIKey | GKVZHNAAJRLMQI-CXAGYDPISA-N |
| SMILES | CC(C)(C)OC(=O)[C@@]12CNC[C@@H]1CN(C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)