Products 2460757-92-8
CAS 2460757-92-8 is the registry number for 3,5-Dimethyl-7-nitroadamantan-1-ol. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 100mg.
3,5-dimethyl-7-nitroadamantan-1-ol (CAS 2460757-92-8) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: 3,5-dimethyl-7-nitroadamantan-1-ol. InChIKey: ZKRLSFWMHYKXNW-UHFFFAOYSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | 3,5-dimethyl-7-nitroadamantan-1-ol |
| InChIKey | ZKRLSFWMHYKXNW-UHFFFAOYSA-N |
| SMILES | CC12CC3(CC(C1)(CC(C2)(C3)O)[N+](=O)[O-])C |
Computed by PubChem (NCBI)