CAS 246141-52-6 appears in our catalog under these names: 4,4'–(1,4–Phenylenebis(ethyne–2,1–diyl))dianiline, 4,4'-(1,4-Phenylenebis(ethyne-2,1-diyl))dianiline 95%, 4,4'-(1,4-Phenylenebis(ethyne-2,1-diyl))dianiline, 95%, 95%, 4,4'-(1,4-Phenylenebis(ethyne-2,1-diyl))dianiline, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
4-[2-[4-[2-(4-aminophenyl)ethynyl]phenyl]ethynyl]aniline (CAS 246141-52-6) is a chemical compound with the molecular formula C22H16N2 and a molecular weight of 308.4 g/mol. IUPAC name: 4-[2-[4-[2-(4-aminophenyl)ethynyl]phenyl]ethynyl]aniline. InChIKey: JWMFORWZSTYTLO-UHFFFAOYSA-N.
| Molecular formula | C22H16N2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 4-[2-[4-[2-(4-aminophenyl)ethynyl]phenyl]ethynyl]aniline |
| InChIKey | JWMFORWZSTYTLO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC2=CC=C(C=C2)N)C#CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)