CAS 1000559-50-1 appears in our catalog under these names: 2,2'-([1,1':4',1''-Terphenyl]-4,4''-diyl)diacetonitrile, 98%, 2,2'–((1,1':4',1''–Terphenyl)–4,4''–Diyl)Diacetonitrile, 2,2'-([1,1':4',1''-Terphenyl]-4,4''-diyl)diacetonitrile 98%, 2,2'-([1,1':4',1''-Terphenyl]-4,4''-diyl)diacetonitrile, 98%, 98%. Offered by: Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 15g, 25g.
2-[4-[4-[4-(cyanomethyl)phenyl]phenyl]phenyl]acetonitrile (CAS 1000559-50-1) is a chemical compound with the molecular formula C22H16N2 and a molecular weight of 308.4 g/mol. IUPAC name: 2-[4-[4-[4-(cyanomethyl)phenyl]phenyl]phenyl]acetonitrile. InChIKey: LOOBBJAIFIHGAO-UHFFFAOYSA-N.
| Molecular formula | C22H16N2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 2-[4-[4-[4-(cyanomethyl)phenyl]phenyl]phenyl]acetonitrile |
| InChIKey | LOOBBJAIFIHGAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC#N)C2=CC=C(C=C2)C3=CC=C(C=C3)CC#N |
Computed by PubChem (NCBI)