CAS 6153-92-0 appears in our catalog under these names: 4,4'-Diphenyl-2,2'-bipyridine, 95-<97%, 4,4'-Diphenyl-2,2'-bipyridine, ≥97-<99%, 4,4′–Diphenyl–2,2′–dipyridyl, 4,4'-Diphenyl-2,2'-bipyridine, 2,2'-Bipyridine, 4,4'-diphenyl-, 98%, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 100mg, 1g, 2g.
4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine (CAS 6153-92-0) is a chemical compound with the molecular formula C22H16N2 and a molecular weight of 308.4 g/mol. IUPAC name: 4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine. InChIKey: OXMSMRJQZMTIMT-UHFFFAOYSA-N.
| Molecular formula | C22H16N2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine |
| InChIKey | OXMSMRJQZMTIMT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC=C2)C3=NC=CC(=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)