CAS 16208-83-6 is the registry number for 2,6-Diphenyl-4,4'-bipyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-diphenyl-4-pyridin-4-ylpyridine (CAS 16208-83-6) is a chemical compound with the molecular formula C22H16N2 and a molecular weight of 308.4 g/mol. IUPAC name: 2,6-diphenyl-4-pyridin-4-ylpyridine. InChIKey: AGVQSEGGWFOUSZ-UHFFFAOYSA-N.
| Molecular formula | C22H16N2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 2,6-diphenyl-4-pyridin-4-ylpyridine |
| InChIKey | AGVQSEGGWFOUSZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=N2)C3=CC=CC=C3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)