Products 2463-49-2
CAS 2463-49-2 is the registry number for 4-O-Methyl-D-glucuronic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 2,5mg.
(2S,3S,4R,5R)-2,4,5-trihydroxy-3-methoxy-6-oxohexanoic acid (CAS 2463-49-2) is a chemical compound with the molecular formula C7H12O7 and a molecular weight of 208.17 g/mol. IUPAC name: (2S,3S,4R,5R)-2,4,5-trihydroxy-3-methoxy-6-oxohexanoic acid. InChIKey: QGGOCWIJGWDKHC-FSIIMWSLSA-N.
| Molecular formula | C7H12O7 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | (2S,3S,4R,5R)-2,4,5-trihydroxy-3-methoxy-6-oxohexanoic acid |
| InChIKey | QGGOCWIJGWDKHC-FSIIMWSLSA-N |
| SMILES | CO[C@@H]([C@@H]([C@H](C=O)O)O)[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
4-O-Methylglucuronic acid, (2S,3S,4R,5R)-2,4,5-trihydroxy-3-methoxy-6-oxohexanoic acid, 4-O-methyl-D-glucuronic acid, 4-O-Methylhexuronic acid, Escitalopram Impurity 73, Glucuronic acid, 4-O-methyl-, orb2695112, (2S,3S,4R,5R)-2,4,5-trihydroxy-3-methoxy-6-oxo-hexanoic acid, rel-(2S,3S,4R,5R)-2,4,5-Trihydroxy-3-methoxy-6-oxohexanoic acid