CAS 52613-19-1 appears in our catalog under these names: Methyl D-Glucuronate, D-Glucuronic acid methyl ester, D-Glucuronic acid methyl ester, 2 g, D-Glucuronic acid methyl ester, 5 g, D-Glucuronic acid methyl ester, 10 g. Offered by: TRC, Biosynth, Roth. Available pack sizes: 10g, 5000mg, 2000mg, 10000mg, 50000mg, 25000mg, 2g, 5g.
Methyl (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate (CAS 52613-19-1) is a chemical compound with the molecular formula C7H12O7 and a molecular weight of 208.17 g/mol. IUPAC name: methyl (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate. InChIKey: UNSKAUSCLTVFGO-FSIIMWSLSA-N.
| Molecular formula | C7H12O7 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
| InChIKey | UNSKAUSCLTVFGO-FSIIMWSLSA-N |
| SMILES | COC(=O)[C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O |
Computed by PubChem (NCBI)