CAS 504397-82-4 is the registry number for (2S)-2-Hydroxy-3-epiquinic Acid. Offered by: TRC. Available pack sizes: 100mg.
(1R,2S,3R,4S,5R)-1,2,3,4,5-pentahydroxycyclohexane-1-carboxylic acid (CAS 504397-82-4) is a chemical compound with the molecular formula C7H12O7 and a molecular weight of 208.17 g/mol. IUPAC name: (1R,2S,3R,4S,5R)-1,2,3,4,5-pentahydroxycyclohexane-1-carboxylic acid. InChIKey: OLBQNCISLUABGO-LNHNIDQWSA-N.
| Molecular formula | C7H12O7 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | (1R,2S,3R,4S,5R)-1,2,3,4,5-pentahydroxycyclohexane-1-carboxylic acid |
| InChIKey | OLBQNCISLUABGO-LNHNIDQWSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@@H]([C@]1(C(=O)O)O)O)O)O)O |
Computed by PubChem (NCBI)