CAS 60046-25-5 is the registry number for D-Glucoheptono-1,4-lactone. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
(4S,5S)-3,4-dihydroxy-5-[(1R,2R)-1,2,3-trihydroxypropyl]oxolan-2-one (CAS 60046-25-5) is a chemical compound with the molecular formula C7H12O7 and a molecular weight of 208.17 g/mol. IUPAC name: (4S,5S)-3,4-dihydroxy-5-[(1R,2R)-1,2,3-trihydroxypropyl]oxolan-2-one. InChIKey: VIVCRCODGMFTFY-JPRIQSOUSA-N.
| Molecular formula | C7H12O7 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | (4S,5S)-3,4-dihydroxy-5-[(1R,2R)-1,2,3-trihydroxypropyl]oxolan-2-one |
| InChIKey | VIVCRCODGMFTFY-JPRIQSOUSA-N |
| SMILES | C([C@H]([C@H]([C@H]1[C@H](C(C(=O)O1)O)O)O)O)O |
Computed by PubChem (NCBI)