CAS 24690-44-6 is the registry number for Erythritol1,2:3,4-dicarbonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-[(4R)-2-oxo-1,3-dioxolan-4-yl]-1,3-dioxolan-2-one (CAS 24690-44-6) is a chemical compound with the molecular formula C6H6O6 and a molecular weight of 174.11 g/mol. IUPAC name: (4S)-4-[(4R)-2-oxo-1,3-dioxolan-4-yl]-1,3-dioxolan-2-one. InChIKey: ZWGIZHOZSXFSNW-ZXZARUISSA-N.
| Molecular formula | C6H6O6 |
|---|---|
| Molecular weight | 174.11 g/mol |
| IUPAC name | (4S)-4-[(4R)-2-oxo-1,3-dioxolan-4-yl]-1,3-dioxolan-2-one |
| InChIKey | ZWGIZHOZSXFSNW-ZXZARUISSA-N |
| SMILES | C1[C@@H](OC(=O)O1)[C@@H]2COC(=O)O2 |
Computed by PubChem (NCBI)