CAS 33124-69-5 is the registry number for Dehydro Ascorbic Acid (threo-2,3-Hexodiulosonic Acid, gama-lactone). Offered by: Chemat Brand. Available pack sizes: on request.
(5S)-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,3,4-trione (CAS 33124-69-5) is a chemical compound with the molecular formula C6H6O6 and a molecular weight of 174.11 g/mol. IUPAC name: (5S)-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,3,4-trione. InChIKey: SBJKKFFYIZUCET-MVHIGOERSA-N.
| Molecular formula | C6H6O6 |
|---|---|
| Molecular weight | 174.11 g/mol |
| IUPAC name | (5S)-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,3,4-trione |
| InChIKey | SBJKKFFYIZUCET-MVHIGOERSA-N |
| SMILES | C([C@H]([C@H]1C(=O)C(=O)C(=O)O1)O)O |
Computed by PubChem (NCBI)