CAS 608-80-0 appears in our catalog under these names: Hexahydroxybenzene, 98%, Hexahydroxybenzene, >95.0%(GC), Benzene-1,2,3,4,5,6-Hexaol, 98%, 98%, Benzene-1,2,3,4,5,6-hexaol, 98%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
Benzene-1,2,3,4,5,6-hexol (CAS 608-80-0) is a chemical compound with the molecular formula C6H6O6 and a molecular weight of 174.11 g/mol. IUPAC name: benzene-1,2,3,4,5,6-hexol. InChIKey: VWPUAXALDFFXJW-UHFFFAOYSA-N.
| Molecular formula | C6H6O6 |
|---|---|
| Molecular weight | 174.11 g/mol |
| IUPAC name | benzene-1,2,3,4,5,6-hexol |
| InChIKey | VWPUAXALDFFXJW-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1O)O)O)O)O)O |
Computed by PubChem (NCBI)