CAS 48126-70-1 is the registry number for Cyclopropane-1,2,3-tricarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclopropane-1,2,3-tricarboxylic acid (CAS 48126-70-1) is a chemical compound with the molecular formula C6H6O6 and a molecular weight of 174.11 g/mol. IUPAC name: cyclopropane-1,2,3-tricarboxylic acid. InChIKey: UVIRSBTTXOHPDA-UHFFFAOYSA-N.
| Molecular formula | C6H6O6 |
|---|---|
| Molecular weight | 174.11 g/mol |
| IUPAC name | cyclopropane-1,2,3-tricarboxylic acid |
| InChIKey | UVIRSBTTXOHPDA-UHFFFAOYSA-N |
| SMILES | C1(C(C1C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)