Products 2469257-98-3
CAS 2469257-98-3 appears in our catalog under these names: 3–Indolepropionic acid–d2, 3-Indolepropionic acid-d2, 99.79%, Indole-3-propionic-2,2-d2 Acid, 98 atom % D, min 98% Chemical Purity, 3-Indolepropionic-d2 Acid, >95% (HPLC), 3-Indolepropionic Acid-d2, 99%, 99%. Offered by: GLPBio, MedChemExpress, CDN, TRC, Chemat. Available pack sizes: 10mg, 1 mg, 10 mg, 5 mg, 0,1g, 0,05g, 25mg, 1mg.
2,2-dideuterio-3-(1H-indol-3-yl)propanoic acid (CAS 2469257-98-3) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 191.22 g/mol. IUPAC name: 2,2-dideuterio-3-(1H-indol-3-yl)propanoic acid. InChIKey: GOLXRNDWAUTYKT-NCYHJHSESA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 191.22 g/mol |
| IUPAC name | 2,2-dideuterio-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | GOLXRNDWAUTYKT-NCYHJHSESA-N |
| SMILES | [2H]C([2H])(CC1=CNC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)