Products 2469555-57-3
CAS 2469555-57-3 appears in our catalog under these names: Bisphenol AP–d5, Bisphenol AP-d5, Bisphenol AP-d5, 95.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 1 mg.
4-[1-(4-hydroxyphenyl)-1-(2,3,4,5,6-pentadeuteriophenyl)ethyl]phenol (CAS 2469555-57-3) is a chemical compound with the molecular formula C20H18O2 and a molecular weight of 295.4 g/mol. IUPAC name: 4-[1-(4-hydroxyphenyl)-1-(2,3,4,5,6-pentadeuteriophenyl)ethyl]phenol. InChIKey: VOWWYDCFAISREI-VIQYUKPQSA-N.
| Molecular formula | C20H18O2 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 4-[1-(4-hydroxyphenyl)-1-(2,3,4,5,6-pentadeuteriophenyl)ethyl]phenol |
| InChIKey | VOWWYDCFAISREI-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C)(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Bisphenol AP-d5