Products 247133-32-0

CAS 247133-32-0 is the registry number for 4-(2-Hydroxyethyl)-1,4-Piperidinedicarboxylic Acid 1-(1,1-Dimethylethyl) 4-Ethyl Ester. Offered by: TRC. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-ethyl 4-(2-hydroxyethyl)piperidine-1,4-dicarboxylate (CAS 247133-32-0) is a chemical compound with the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 4-(2-hydroxyethyl)piperidine-1,4-dicarboxylate. InChIKey: IYPUGIZFMJLQBI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H27NO5
Molecular weight301.38 g/mol
IUPAC name1-O-tert-butyl 4-O-ethyl 4-(2-hydroxyethyl)piperidine-1,4-dicarboxylate
InChIKeyIYPUGIZFMJLQBI-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)CCO

Computed by PubChem (NCBI)