CAS 247170-27-0 appears in our catalog under these names: 3-Fluoro-4-(trifluoromethyl)benzamide, 97%, 3-Fluoro-4-(trifluoromethyl)benzamide, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
3-fluoro-4-(trifluoromethyl)benzamide (CAS 247170-27-0) is a chemical compound with the molecular formula C8H5F4NO and a molecular weight of 207.12 g/mol. IUPAC name: 3-fluoro-4-(trifluoromethyl)benzamide. InChIKey: LGDDDQBFEWZCEW-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO |
|---|---|
| Molecular weight | 207.12 g/mol |
| IUPAC name | 3-fluoro-4-(trifluoromethyl)benzamide |
| InChIKey | LGDDDQBFEWZCEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)F)C(F)(F)F |
Computed by PubChem (NCBI)