CAS 247225-90-7 is the registry number for 6,8-Dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid (CAS 247225-90-7) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 243.30 g/mol. IUPAC name: 6,8-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid. InChIKey: AUAYMJLUZNBPQT-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 6,8-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid |
| InChIKey | AUAYMJLUZNBPQT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C3C=CCC3C(N2)C(=O)O)C |
Computed by PubChem (NCBI)