CAS 2475-78-7 appears in our catalog under these names: Methyl 2-amino-5-ethylbenzoate, 97+%, Methyl 2-amino-5-ethylbenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Methyl 2-amino-5-ethylbenzoate (CAS 2475-78-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 2-amino-5-ethylbenzoate. InChIKey: ZJDZGWIALYBAIL-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 2-amino-5-ethylbenzoate |
| InChIKey | ZJDZGWIALYBAIL-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)N)C(=O)OC |
Computed by PubChem (NCBI)