Products 2480090-03-5
CAS 2480090-03-5 is the registry number for Aldose reductase-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[8-[(E)-2-(4-hydroxyphenyl)ethenyl]-2-oxo-3H-1,4-benzoxazin-4-yl]acetic acid (CAS 2480090-03-5) is a chemical compound with the molecular formula C18H15NO5 and a molecular weight of 325.3 g/mol. IUPAC name: 2-[8-[(E)-2-(4-hydroxyphenyl)ethenyl]-2-oxo-3H-1,4-benzoxazin-4-yl]acetic acid. InChIKey: VYIPBSOCLBYEIE-QPJJXVBHSA-N.
| Molecular formula | C18H15NO5 |
|---|---|
| Molecular weight | 325.3 g/mol |
| IUPAC name | 2-[8-[(E)-2-(4-hydroxyphenyl)ethenyl]-2-oxo-3H-1,4-benzoxazin-4-yl]acetic acid |
| InChIKey | VYIPBSOCLBYEIE-QPJJXVBHSA-N |
| SMILES | C1C(=O)OC2=C(C=CC=C2N1CC(=O)O)/C=C/C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)
Synonyms:
Aldose reductase-IN-5